C22H26ClN3O5S — CID 16546072
2-(2-chlorophenoxy)-N-(5-morpholin-4-ylsulfonyl-2-pyrrolidin-1-ylphenyl)acetamide (PubChem CID 16546072) has the molecular formula C22H26ClN3O5S and a molecular weight of 479.99 g/mol. Its IUPAC name is 2-(2-chlorophenoxy)-N-(5-morpholin-4-ylsulfonyl-2-pyrrolidin-1-ylphenyl)acetamide.
| Compound Name | 2-(2-chlorophenoxy)-N-(5-morpholin-4-ylsulfonyl-2-pyrrolidin-1-ylphenyl)acetamide |
|---|---|
| PubChem CID | 16546072 |
| Molecular Formula | C22H26ClN3O5S |
| Molecular Weight | 479.99 g/mol |
| Exact Mass | 479.13 |
| IUPAC Name | 2-(2-chlorophenoxy)-N-(5-morpholin-4-ylsulfonyl-2-pyrrolidin-1-ylphenyl)acetamide |
| SMILES | O=C(COc1ccccc1Cl)Nc1cc(S(=O)(=O)N2CCOCC2)ccc1N1CCCC1 |
| InChI | InChI=1S/C22H26ClN3O5S/c23-18-5-1-2-6-21(18)31-16-22(27)24-19-15-17(7-8-20(19)25-9-3-4-10-25)32(28,29)26-11-13-30-14-12-26/h1-2,5-8,15H,3-4,9-14,16H2,(H,24,27) |
| InChIKey | NVHLICWCXTYJFJ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.99 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |