C10H11N3OS — CID 165460819
6-(2-methylazetidin-1-yl)imidazo[2,1-b][1,3]thiazole-5-carbaldehyde (PubChem CID 165460819) has the molecular formula C10H11N3OS and a molecular weight of 221.28 g/mol. Its IUPAC name is 6-(2-methylazetidin-1-yl)imidazo[2,1-b][1,3]thiazole-5-carbaldehyde.
| Compound Name | 6-(2-methylazetidin-1-yl)imidazo[2,1-b][1,3]thiazole-5-carbaldehyde |
|---|---|
| PubChem CID | 165460819 |
| Molecular Formula | C10H11N3OS |
| Molecular Weight | 221.28 g/mol |
| Exact Mass | 221.06 |
| IUPAC Name | 6-(2-methylazetidin-1-yl)imidazo[2,1-b][1,3]thiazole-5-carbaldehyde |
| SMILES | CC1CCN1c1nc2sccn2c1C=O |
| InChI | InChI=1S/C10H11N3OS/c1-7-2-3-12(7)9-8(6-14)13-4-5-15-10(13)11-9/h4-7H,2-3H2,1H3 |
| InChIKey | LGELOUVIUHWLQZ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 37.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.28 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|