About 5-(3-methyl-1,4-thiazepan-4-yl)furan-2-carbaldehyde
5-(3-methyl-1,4-thiazepan-4-yl)furan-2-carbaldehyde (PubChem CID 165460877) has the molecular formula C11H15NO2S
and a molecular weight of 225.31 g/mol. Its IUPAC name is 5-(3-methyl-1,4-thiazepan-4-yl)furan-2-carbaldehyde.
Molecular Properties
| Compound Name | 5-(3-methyl-1,4-thiazepan-4-yl)furan-2-carbaldehyde |
| PubChem CID | 165460877 |
| Molecular Formula | C11H15NO2S |
| Molecular Weight | 225.31 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | 5-(3-methyl-1,4-thiazepan-4-yl)furan-2-carbaldehyde |
| SMILES | CC1CSCCCN1c1ccc(C=O)o1 |
| InChI | InChI=1S/C11H15NO2S/c1-9-8-15-6-2-5-12(9)11-4-3-10(7-13)14-11/h3-4,7,9H,2,5-6,8H2,1H3 |
| InChIKey | VKBRFPUUXUMVQO-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.31 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 5-(3-methyl-1,4-thiazepan-4-yl)furan-2-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3-methyl-1,4-thiazepan-4-yl)furan-2-carbaldehyde?
The IUPAC name of 5-(3-methyl-1,4-thiazepan-4-yl)furan-2-carbaldehyde (CID 165460877) is 5-(3-methyl-1,4-thiazepan-4-yl)furan-2-carbaldehyde.
What is the SMILES notation for 5-(3-methyl-1,4-thiazepan-4-yl)furan-2-carbaldehyde?
The canonical SMILES for 5-(3-methyl-1,4-thiazepan-4-yl)furan-2-carbaldehyde is CC1CSCCCN1c1ccc(C=O)o1.
What is the InChIKey of 5-(3-methyl-1,4-thiazepan-4-yl)furan-2-carbaldehyde?
The InChIKey is VKBRFPUUXUMVQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO2S/c1-9-8-15-6-2-5-12(9)11-4-3-10(7-13)14-11/h3-4,7,9H,2,5-6,8H2,1H3.
What are the key properties of 5-(3-methyl-1,4-thiazepan-4-yl)furan-2-carbaldehyde?
5-(3-methyl-1,4-thiazepan-4-yl)furan-2-carbaldehyde has a molecular weight of 225.31 g/mol, XLogP of 2.42, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3-methyl-1,4-thiazepan-4-yl)furan-2-carbaldehyde is sourced from PubChem (CID 165460877), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).