cis-(1R,2S)-2-methoxycyclopentane-1-sulfonyl fluoride

C6H11FO3S — CID 165461080

IUPACcis-(1R,2S)-2-methoxycyclopentane-1-sulfonyl fluoride
SMILESCO[C@H]1CCC[C@H]1S(=O)(=O)F
InChIInChI=1S/C6H11FO3S/c1-10-5-3-2-4-6(5)11(7,8)9/h5-6H,2-4H2,1H3/t5-,6+/m0/s1
InChIKeyYHDNFOFCQVYGBP-NTSWFWBYSA-N
MW182.22 g/mol
LogP0.85
Rot. Bonds2

About cis-(1R,2S)-2-methoxycyclopentane-1-sulfonyl fluoride

cis-(1R,2S)-2-methoxycyclopentane-1-sulfonyl fluoride (PubChem CID 165461080) has the molecular formula C6H11FO3S and a molecular weight of 182.22 g/mol. Its IUPAC name is cis-(1R,2S)-2-methoxycyclopentane-1-sulfonyl fluoride.

Molecular Properties

Compound Namecis-(1R,2S)-2-methoxycyclopentane-1-sulfonyl fluoride
PubChem CID165461080
Molecular FormulaC6H11FO3S
Molecular Weight182.22 g/mol
Exact Mass182.04
IUPAC Namecis-(1R,2S)-2-methoxycyclopentane-1-sulfonyl fluoride
SMILESCO[C@H]1CCC[C@H]1S(=O)(=O)F
InChIInChI=1S/C6H11FO3S/c1-10-5-3-2-4-6(5)11(7,8)9/h5-6H,2-4H2,1H3/t5-,6+/m0/s1
InChIKeyYHDNFOFCQVYGBP-NTSWFWBYSA-N
XLogP0.85
TPSA43.37 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500182.22
LogP ≤ 50.85
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze cis-(1R,2S)-2-methoxycyclopentane-1-sulfonyl fluoride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

rac-(1R,2S)-2-methoxycyclopentane-1-sulfonyl chloride
CID 122163732
rac-(1R,2S)-2-(propan-2-yloxy)cyclopentane-1-sulfonyl chloride
CID 138039759
trans-(1S,2S)-2-methoxycyclopentane-1-sulfonyl chloride
CID 124709179
Oxolan-2-ylmethanesulfonyl fluoride
CID 122236584
[(2R)-oxolan-2-yl]methanesulfonyl fluoride
CID 124870712
[(2S)-oxolan-2-yl]methanesulfonyl fluoride
CID 124870713
2-Methoxypentane-1-sulfonyl fluoride
CID 164664043
2-Hydroxycyclopentane-1-sulfonyl fluoride
CID 165452588
(1R,2R)-2-methoxycyclopentane-1-sulfonyl fluoride
CID 165453431
rac-(1R,2S)-2-methoxycyclopentane-1-sulfonyl fluoride
CID 165459359
2-Methyloxolane-3-sulfonyl fluoride
CID 165460627
5-Methoxypentane-2-sulfonyl fluoride
CID 165502132

Frequently Asked Questions

What is the IUPAC name of cis-(1R,2S)-2-methoxycyclopentane-1-sulfonyl fluoride?
The IUPAC name of cis-(1R,2S)-2-methoxycyclopentane-1-sulfonyl fluoride (CID 165461080) is cis-(1R,2S)-2-methoxycyclopentane-1-sulfonyl fluoride.
What is the SMILES notation for cis-(1R,2S)-2-methoxycyclopentane-1-sulfonyl fluoride?
The canonical SMILES for cis-(1R,2S)-2-methoxycyclopentane-1-sulfonyl fluoride is CO[C@H]1CCC[C@H]1S(=O)(=O)F.
What is the InChIKey of cis-(1R,2S)-2-methoxycyclopentane-1-sulfonyl fluoride?
The InChIKey is YHDNFOFCQVYGBP-NTSWFWBYSA-N. The full InChI is InChI=1S/C6H11FO3S/c1-10-5-3-2-4-6(5)11(7,8)9/h5-6H,2-4H2,1H3/t5-,6+/m0/s1.
What are the key properties of cis-(1R,2S)-2-methoxycyclopentane-1-sulfonyl fluoride?
cis-(1R,2S)-2-methoxycyclopentane-1-sulfonyl fluoride has a molecular weight of 182.22 g/mol, XLogP of 0.85, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(1R,2S)-2-methoxycyclopentane-1-sulfonyl fluoride is sourced from PubChem (CID 165461080), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).