About 1-hexyl-2,4-dioxopyrimidine-5-sulfonyl fluoride
1-hexyl-2,4-dioxopyrimidine-5-sulfonyl fluoride (PubChem CID 165461312) has the molecular formula C10H15FN2O4S
and a molecular weight of 278.30 g/mol. Its IUPAC name is 1-hexyl-2,4-dioxopyrimidine-5-sulfonyl fluoride.
Molecular Properties
| Compound Name | 1-hexyl-2,4-dioxopyrimidine-5-sulfonyl fluoride |
| PubChem CID | 165461312 |
| Molecular Formula | C10H15FN2O4S |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | 1-hexyl-2,4-dioxopyrimidine-5-sulfonyl fluoride |
| SMILES | CCCCCCn1cc(S(=O)(=O)F)c(=O)[nH]c1=O |
| InChI | InChI=1S/C10H15FN2O4S/c1-2-3-4-5-6-13-7-8(18(11,16)17)9(14)12-10(13)15/h7H,2-6H2,1H3,(H,12,14,15) |
| InChIKey | HPVZAPOVSPTYIM-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 89.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-hexyl-2,4-dioxopyrimidine-5-sulfonyl fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hexyl-2,4-dioxopyrimidine-5-sulfonyl fluoride?
The IUPAC name of 1-hexyl-2,4-dioxopyrimidine-5-sulfonyl fluoride (CID 165461312) is 1-hexyl-2,4-dioxopyrimidine-5-sulfonyl fluoride.
What is the SMILES notation for 1-hexyl-2,4-dioxopyrimidine-5-sulfonyl fluoride?
The canonical SMILES for 1-hexyl-2,4-dioxopyrimidine-5-sulfonyl fluoride is CCCCCCn1cc(S(=O)(=O)F)c(=O)[nH]c1=O.
What is the InChIKey of 1-hexyl-2,4-dioxopyrimidine-5-sulfonyl fluoride?
The InChIKey is HPVZAPOVSPTYIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15FN2O4S/c1-2-3-4-5-6-13-7-8(18(11,16)17)9(14)12-10(13)15/h7H,2-6H2,1H3,(H,12,14,15).
What are the key properties of 1-hexyl-2,4-dioxopyrimidine-5-sulfonyl fluoride?
1-hexyl-2,4-dioxopyrimidine-5-sulfonyl fluoride has a molecular weight of 278.30 g/mol, XLogP of 0.78, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hexyl-2,4-dioxopyrimidine-5-sulfonyl fluoride is sourced from PubChem (CID 165461312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).