C17H13BrClNO2 — CID 16546165
N-(4-bromo-2-methylphenyl)-7-chloro-3-methyl-1-benzofuran-2-carboxamide (PubChem CID 16546165) has the molecular formula C17H13BrClNO2 and a molecular weight of 378.65 g/mol. Its IUPAC name is N-(4-bromo-2-methylphenyl)-7-chloro-3-methyl-1-benzofuran-2-carboxamide.
| Compound Name | N-(4-bromo-2-methylphenyl)-7-chloro-3-methyl-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 16546165 |
| Molecular Formula | C17H13BrClNO2 |
| Molecular Weight | 378.65 g/mol |
| Exact Mass | 376.98 |
| IUPAC Name | N-(4-bromo-2-methylphenyl)-7-chloro-3-methyl-1-benzofuran-2-carboxamide |
| SMILES | Cc1cc(Br)ccc1NC(=O)c1oc2c(Cl)cccc2c1C |
| InChI | InChI=1S/C17H13BrClNO2/c1-9-8-11(18)6-7-14(9)20-17(21)15-10(2)12-4-3-5-13(19)16(12)22-15/h3-8H,1-2H3,(H,20,21) |
| InChIKey | BDZWYJYEWDITLN-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.65 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |