C19H21N3O2S2 — CID 16546198
7a-methyl-N-[3-[(4-methylphenyl)methyl]-1,3-thiazol-2-ylidene]-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide (PubChem CID 16546198) has the molecular formula C19H21N3O2S2 and a molecular weight of 387.53 g/mol. Its IUPAC name is 7a-methyl-N-[3-[(4-methylphenyl)methyl]-1,3-thiazol-2-ylidene]-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide.
| Compound Name | 7a-methyl-N-[3-[(4-methylphenyl)methyl]-1,3-thiazol-2-ylidene]-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide |
|---|---|
| PubChem CID | 16546198 |
| Molecular Formula | C19H21N3O2S2 |
| Molecular Weight | 387.53 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | 7a-methyl-N-[3-[(4-methylphenyl)methyl]-1,3-thiazol-2-ylidene]-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide |
| SMILES | Cc1ccc(Cn2ccs/c2=N\C(=O)C2CSC3(C)CCC(=O)N23)cc1 |
| InChI | InChI=1S/C19H21N3O2S2/c1-13-3-5-14(6-4-13)11-21-9-10-25-18(21)20-17(24)15-12-26-19(2)8-7-16(23)22(15)19/h3-6,9-10,15H,7-8,11-12H2,1-2H3/b20-18- |
| InChIKey | VROFDQAZERRLBW-ZZEZOPTASA-N |
| XLogP | 2.79 |
| TPSA | 54.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.53 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |