About 3-[ethyl(2-methylprop-2-enyl)amino]-2,2-difluoropropanoic acid
3-[ethyl(2-methylprop-2-enyl)amino]-2,2-difluoropropanoic acid (PubChem CID 165462205) has the molecular formula C9H15F2NO2
and a molecular weight of 207.22 g/mol. Its IUPAC name is 3-[ethyl(2-methylprop-2-enyl)amino]-2,2-difluoropropanoic acid.
Molecular Properties
| Compound Name | 3-[ethyl(2-methylprop-2-enyl)amino]-2,2-difluoropropanoic acid |
| PubChem CID | 165462205 |
| Molecular Formula | C9H15F2NO2 |
| Molecular Weight | 207.22 g/mol |
| Exact Mass | 207.11 |
| IUPAC Name | 3-[ethyl(2-methylprop-2-enyl)amino]-2,2-difluoropropanoic acid |
| SMILES | C=C(C)CN(CC)CC(F)(F)C(=O)O |
| InChI | InChI=1S/C9H15F2NO2/c1-4-12(5-7(2)3)6-9(10,11)8(13)14/h2,4-6H2,1,3H3,(H,13,14) |
| InChIKey | AKVADOFGZPTGSX-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.22 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-[ethyl(2-methylprop-2-enyl)amino]-2,2-difluoropropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[ethyl(2-methylprop-2-enyl)amino]-2,2-difluoropropanoic acid?
The IUPAC name of 3-[ethyl(2-methylprop-2-enyl)amino]-2,2-difluoropropanoic acid (CID 165462205) is 3-[ethyl(2-methylprop-2-enyl)amino]-2,2-difluoropropanoic acid.
What is the SMILES notation for 3-[ethyl(2-methylprop-2-enyl)amino]-2,2-difluoropropanoic acid?
The canonical SMILES for 3-[ethyl(2-methylprop-2-enyl)amino]-2,2-difluoropropanoic acid is C=C(C)CN(CC)CC(F)(F)C(=O)O.
What is the InChIKey of 3-[ethyl(2-methylprop-2-enyl)amino]-2,2-difluoropropanoic acid?
The InChIKey is AKVADOFGZPTGSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15F2NO2/c1-4-12(5-7(2)3)6-9(10,11)8(13)14/h2,4-6H2,1,3H3,(H,13,14).
What are the key properties of 3-[ethyl(2-methylprop-2-enyl)amino]-2,2-difluoropropanoic acid?
3-[ethyl(2-methylprop-2-enyl)amino]-2,2-difluoropropanoic acid has a molecular weight of 207.22 g/mol, XLogP of 1.60, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[ethyl(2-methylprop-2-enyl)amino]-2,2-difluoropropanoic acid is sourced from PubChem (CID 165462205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).