About 3-(2,2-difluoro-3-hydrazinyl-3-oxopropyl)sulfanylpropanamide
3-(2,2-difluoro-3-hydrazinyl-3-oxopropyl)sulfanylpropanamide (PubChem CID 165462273) has the molecular formula C6H11F2N3O2S
and a molecular weight of 227.24 g/mol. Its IUPAC name is 3-(2,2-difluoro-3-hydrazinyl-3-oxopropyl)sulfanylpropanamide.
Molecular Properties
| Compound Name | 3-(2,2-difluoro-3-hydrazinyl-3-oxopropyl)sulfanylpropanamide |
| PubChem CID | 165462273 |
| Molecular Formula | C6H11F2N3O2S |
| Molecular Weight | 227.24 g/mol |
| Exact Mass | 227.05 |
| IUPAC Name | 3-(2,2-difluoro-3-hydrazinyl-3-oxopropyl)sulfanylpropanamide |
| SMILES | NNC(=O)C(F)(F)CSCCC(N)=O |
| InChI | InChI=1S/C6H11F2N3O2S/c7-6(8,5(13)11-10)3-14-2-1-4(9)12/h1-3,10H2,(H2,9,12)(H,11,13) |
| InChIKey | YBJSFAYPRAETMM-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.24 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-(2,2-difluoro-3-hydrazinyl-3-oxopropyl)sulfanylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,2-difluoro-3-hydrazinyl-3-oxopropyl)sulfanylpropanamide?
The IUPAC name of 3-(2,2-difluoro-3-hydrazinyl-3-oxopropyl)sulfanylpropanamide (CID 165462273) is 3-(2,2-difluoro-3-hydrazinyl-3-oxopropyl)sulfanylpropanamide.
What is the SMILES notation for 3-(2,2-difluoro-3-hydrazinyl-3-oxopropyl)sulfanylpropanamide?
The canonical SMILES for 3-(2,2-difluoro-3-hydrazinyl-3-oxopropyl)sulfanylpropanamide is NNC(=O)C(F)(F)CSCCC(N)=O.
What is the InChIKey of 3-(2,2-difluoro-3-hydrazinyl-3-oxopropyl)sulfanylpropanamide?
The InChIKey is YBJSFAYPRAETMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11F2N3O2S/c7-6(8,5(13)11-10)3-14-2-1-4(9)12/h1-3,10H2,(H2,9,12)(H,11,13).
What are the key properties of 3-(2,2-difluoro-3-hydrazinyl-3-oxopropyl)sulfanylpropanamide?
3-(2,2-difluoro-3-hydrazinyl-3-oxopropyl)sulfanylpropanamide has a molecular weight of 227.24 g/mol, XLogP of -0.78, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,2-difluoro-3-hydrazinyl-3-oxopropyl)sulfanylpropanamide is sourced from PubChem (CID 165462273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).