About 2-(trichloromethyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine
2-(trichloromethyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine (PubChem CID 165462414) has the molecular formula C8H8Cl3N3
and a molecular weight of 252.53 g/mol. Its IUPAC name is 2-(trichloromethyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | 2-(trichloromethyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine |
| PubChem CID | 165462414 |
| Molecular Formula | C8H8Cl3N3 |
| Molecular Weight | 252.53 g/mol |
| Exact Mass | 250.98 |
| IUPAC Name | 2-(trichloromethyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine |
| SMILES | Nc1nc(C(Cl)(Cl)Cl)nc2c1CCC2 |
| InChI | InChI=1S/C8H8Cl3N3/c9-8(10,11)7-13-5-3-1-2-4(5)6(12)14-7/h1-3H2,(H2,12,13,14) |
| InChIKey | RZGLBILOJFEERR-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.53 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-(trichloromethyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(trichloromethyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine?
The IUPAC name of 2-(trichloromethyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine (CID 165462414) is 2-(trichloromethyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine.
What is the SMILES notation for 2-(trichloromethyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine?
The canonical SMILES for 2-(trichloromethyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine is Nc1nc(C(Cl)(Cl)Cl)nc2c1CCC2.
What is the InChIKey of 2-(trichloromethyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine?
The InChIKey is RZGLBILOJFEERR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8Cl3N3/c9-8(10,11)7-13-5-3-1-2-4(5)6(12)14-7/h1-3H2,(H2,12,13,14).
What are the key properties of 2-(trichloromethyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine?
2-(trichloromethyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine has a molecular weight of 252.53 g/mol, XLogP of 2.37, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(trichloromethyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine is sourced from PubChem (CID 165462414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).