About methyl 7-methoxy-5-methyl-2,3-dihydro-1-benzofuran-3-carboxylate
methyl 7-methoxy-5-methyl-2,3-dihydro-1-benzofuran-3-carboxylate (PubChem CID 165462888) has the molecular formula C12H14O4
and a molecular weight of 222.24 g/mol. Its IUPAC name is methyl 7-methoxy-5-methyl-2,3-dihydro-1-benzofuran-3-carboxylate.
Molecular Properties
| Compound Name | methyl 7-methoxy-5-methyl-2,3-dihydro-1-benzofuran-3-carboxylate |
| PubChem CID | 165462888 |
| Molecular Formula | C12H14O4 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | methyl 7-methoxy-5-methyl-2,3-dihydro-1-benzofuran-3-carboxylate |
| SMILES | COC(=O)C1COc2c(OC)cc(C)cc21 |
| InChI | InChI=1S/C12H14O4/c1-7-4-8-9(12(13)15-3)6-16-11(8)10(5-7)14-2/h4-5,9H,6H2,1-3H3 |
| InChIKey | GSLLZLFJHJOYBY-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 7-methoxy-5-methyl-2,3-dihydro-1-benzofuran-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 7-methoxy-5-methyl-2,3-dihydro-1-benzofuran-3-carboxylate?
The IUPAC name of methyl 7-methoxy-5-methyl-2,3-dihydro-1-benzofuran-3-carboxylate (CID 165462888) is methyl 7-methoxy-5-methyl-2,3-dihydro-1-benzofuran-3-carboxylate.
What is the SMILES notation for methyl 7-methoxy-5-methyl-2,3-dihydro-1-benzofuran-3-carboxylate?
The canonical SMILES for methyl 7-methoxy-5-methyl-2,3-dihydro-1-benzofuran-3-carboxylate is COC(=O)C1COc2c(OC)cc(C)cc21.
What is the InChIKey of methyl 7-methoxy-5-methyl-2,3-dihydro-1-benzofuran-3-carboxylate?
The InChIKey is GSLLZLFJHJOYBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14O4/c1-7-4-8-9(12(13)15-3)6-16-11(8)10(5-7)14-2/h4-5,9H,6H2,1-3H3.
What are the key properties of methyl 7-methoxy-5-methyl-2,3-dihydro-1-benzofuran-3-carboxylate?
methyl 7-methoxy-5-methyl-2,3-dihydro-1-benzofuran-3-carboxylate has a molecular weight of 222.24 g/mol, XLogP of 1.65, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 7-methoxy-5-methyl-2,3-dihydro-1-benzofuran-3-carboxylate is sourced from PubChem (CID 165462888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).