About 3-pyridazin-4-ylpropane-1,2-diamine
3-pyridazin-4-ylpropane-1,2-diamine (PubChem CID 165462937) has the molecular formula C7H12N4
and a molecular weight of 152.20 g/mol. Its IUPAC name is 3-pyridazin-4-ylpropane-1,2-diamine.
Molecular Properties
| Compound Name | 3-pyridazin-4-ylpropane-1,2-diamine |
| PubChem CID | 165462937 |
| Molecular Formula | C7H12N4 |
| Molecular Weight | 152.20 g/mol |
| Exact Mass | 152.11 |
| IUPAC Name | 3-pyridazin-4-ylpropane-1,2-diamine |
| SMILES | NCC(N)Cc1ccnnc1 |
| InChI | InChI=1S/C7H12N4/c8-4-7(9)3-6-1-2-10-11-5-6/h1-2,5,7H,3-4,8-9H2 |
| InChIKey | ATGQAQCMPNHPNW-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.20 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-pyridazin-4-ylpropane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-pyridazin-4-ylpropane-1,2-diamine?
The IUPAC name of 3-pyridazin-4-ylpropane-1,2-diamine (CID 165462937) is 3-pyridazin-4-ylpropane-1,2-diamine.
What is the SMILES notation for 3-pyridazin-4-ylpropane-1,2-diamine?
The canonical SMILES for 3-pyridazin-4-ylpropane-1,2-diamine is NCC(N)Cc1ccnnc1.
What is the InChIKey of 3-pyridazin-4-ylpropane-1,2-diamine?
The InChIKey is ATGQAQCMPNHPNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N4/c8-4-7(9)3-6-1-2-10-11-5-6/h1-2,5,7H,3-4,8-9H2.
What are the key properties of 3-pyridazin-4-ylpropane-1,2-diamine?
3-pyridazin-4-ylpropane-1,2-diamine has a molecular weight of 152.20 g/mol, XLogP of -0.69, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-pyridazin-4-ylpropane-1,2-diamine is sourced from PubChem (CID 165462937), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).