4-ethyl-5-propyl-1,2,4-triazole-3-sulfonyl fluoride

C7H12FN3O2S — CID 165462994

IUPAC4-ethyl-5-propyl-1,2,4-triazole-3-sulfonyl fluoride
SMILESCCCc1nnc(S(=O)(=O)F)n1CC
InChIInChI=1S/C7H12FN3O2S/c1-3-5-6-9-10-7(11(6)4-2)14(8,12)13/h3-5H2,1-2H3
InChIKeyOJQKLLXNLKUGOO-UHFFFAOYSA-N
MW221.26 g/mol
LogP0.91
Rot. Bonds4

About 4-ethyl-5-propyl-1,2,4-triazole-3-sulfonyl fluoride

4-ethyl-5-propyl-1,2,4-triazole-3-sulfonyl fluoride (PubChem CID 165462994) has the molecular formula C7H12FN3O2S and a molecular weight of 221.26 g/mol. Its IUPAC name is 4-ethyl-5-propyl-1,2,4-triazole-3-sulfonyl fluoride.

Molecular Properties

Compound Name4-ethyl-5-propyl-1,2,4-triazole-3-sulfonyl fluoride
PubChem CID165462994
Molecular FormulaC7H12FN3O2S
Molecular Weight221.26 g/mol
Exact Mass221.06
IUPAC Name4-ethyl-5-propyl-1,2,4-triazole-3-sulfonyl fluoride
SMILESCCCc1nnc(S(=O)(=O)F)n1CC
InChIInChI=1S/C7H12FN3O2S/c1-3-5-6-9-10-7(11(6)4-2)14(8,12)13/h3-5H2,1-2H3
InChIKeyOJQKLLXNLKUGOO-UHFFFAOYSA-N
XLogP0.91
TPSA64.85 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500221.26
LogP ≤ 50.91
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze 4-ethyl-5-propyl-1,2,4-triazole-3-sulfonyl fluoride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-ethyl-5-propyl-1,2,4-triazole-3-sulfonyl fluoride?
The IUPAC name of 4-ethyl-5-propyl-1,2,4-triazole-3-sulfonyl fluoride (CID 165462994) is 4-ethyl-5-propyl-1,2,4-triazole-3-sulfonyl fluoride.
What is the SMILES notation for 4-ethyl-5-propyl-1,2,4-triazole-3-sulfonyl fluoride?
The canonical SMILES for 4-ethyl-5-propyl-1,2,4-triazole-3-sulfonyl fluoride is CCCc1nnc(S(=O)(=O)F)n1CC.
What is the InChIKey of 4-ethyl-5-propyl-1,2,4-triazole-3-sulfonyl fluoride?
The InChIKey is OJQKLLXNLKUGOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12FN3O2S/c1-3-5-6-9-10-7(11(6)4-2)14(8,12)13/h3-5H2,1-2H3.
What are the key properties of 4-ethyl-5-propyl-1,2,4-triazole-3-sulfonyl fluoride?
4-ethyl-5-propyl-1,2,4-triazole-3-sulfonyl fluoride has a molecular weight of 221.26 g/mol, XLogP of 0.91, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-5-propyl-1,2,4-triazole-3-sulfonyl fluoride is sourced from PubChem (CID 165462994), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).