C8H15N5 — CID 165463200
N-methyl-1-(3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-6-yl)methanamine (PubChem CID 165463200) has the molecular formula C8H15N5 and a molecular weight of 181.24 g/mol. Its IUPAC name is N-methyl-1-(3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-6-yl)methanamine.
| Compound Name | N-methyl-1-(3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-6-yl)methanamine |
|---|---|
| PubChem CID | 165463200 |
| Molecular Formula | C8H15N5 |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.13 |
| IUPAC Name | N-methyl-1-(3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-6-yl)methanamine |
| SMILES | CNCC1Cn2c(C)nnc2CN1 |
| InChI | InChI=1S/C8H15N5/c1-6-11-12-8-4-10-7(3-9-2)5-13(6)8/h7,9-10H,3-5H2,1-2H3 |
| InChIKey | GYSRGZINBYRWAM-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 54.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |