C13H26N2O — CID 165463507
(2R,6S)-4-(3,5-dimethylpiperidin-4-yl)-2,6-dimethylmorpholine (PubChem CID 165463507) has the molecular formula C13H26N2O and a molecular weight of 226.36 g/mol. Its IUPAC name is (2R,6S)-4-(3,5-dimethylpiperidin-4-yl)-2,6-dimethylmorpholine.
| Compound Name | (2R,6S)-4-(3,5-dimethylpiperidin-4-yl)-2,6-dimethylmorpholine |
|---|---|
| PubChem CID | 165463507 |
| Molecular Formula | C13H26N2O |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.20 |
| IUPAC Name | (2R,6S)-4-(3,5-dimethylpiperidin-4-yl)-2,6-dimethylmorpholine |
| SMILES | CC1CNCC(C)C1N1C[C@@H](C)O[C@@H](C)C1 |
| InChI | InChI=1S/C13H26N2O/c1-9-5-14-6-10(2)13(9)15-7-11(3)16-12(4)8-15/h9-14H,5-8H2,1-4H3/t9?,10?,11-,12+,13? |
| InChIKey | JRXAFXCGPCZSIK-ACDMLXGOSA-N |
| XLogP | 1.34 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |