C9H14F3N3S — CID 165463642
3-pentyl-4-(2,2,2-trifluoroethyl)-1H-1,2,4-triazole-5-thione (PubChem CID 165463642) has the molecular formula C9H14F3N3S and a molecular weight of 253.29 g/mol. Its IUPAC name is 3-pentyl-4-(2,2,2-trifluoroethyl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-pentyl-4-(2,2,2-trifluoroethyl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 165463642 |
| Molecular Formula | C9H14F3N3S |
| Molecular Weight | 253.29 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | 3-pentyl-4-(2,2,2-trifluoroethyl)-1H-1,2,4-triazole-5-thione |
| SMILES | CCCCCc1n[nH]c(=S)n1CC(F)(F)F |
| InChI | InChI=1S/C9H14F3N3S/c1-2-3-4-5-7-13-14-8(16)15(7)6-9(10,11)12/h2-6H2,1H3,(H,14,16) |
| InChIKey | YGNGQFPCBCPIMS-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 33.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.29 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|