C11H21N3OS — CID 165463704
3-(2,2-dimethylpropyl)-4-(2-ethoxyethyl)-1H-1,2,4-triazole-5-thione (PubChem CID 165463704) has the molecular formula C11H21N3OS and a molecular weight of 243.38 g/mol. Its IUPAC name is 3-(2,2-dimethylpropyl)-4-(2-ethoxyethyl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-(2,2-dimethylpropyl)-4-(2-ethoxyethyl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 165463704 |
| Molecular Formula | C11H21N3OS |
| Molecular Weight | 243.38 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | 3-(2,2-dimethylpropyl)-4-(2-ethoxyethyl)-1H-1,2,4-triazole-5-thione |
| SMILES | CCOCCn1c(CC(C)(C)C)n[nH]c1=S |
| InChI | InChI=1S/C11H21N3OS/c1-5-15-7-6-14-9(8-11(2,3)4)12-13-10(14)16/h5-8H2,1-4H3,(H,13,16) |
| InChIKey | SYODZWSCCSEWFK-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 42.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.38 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|