C10H17N3S — CID 165463710
4-butyl-3-cyclobutyl-1H-1,2,4-triazole-5-thione (PubChem CID 165463710) has the molecular formula C10H17N3S and a molecular weight of 211.33 g/mol. Its IUPAC name is 4-butyl-3-cyclobutyl-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-butyl-3-cyclobutyl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 165463710 |
| Molecular Formula | C10H17N3S |
| Molecular Weight | 211.33 g/mol |
| Exact Mass | 211.11 |
| IUPAC Name | 4-butyl-3-cyclobutyl-1H-1,2,4-triazole-5-thione |
| SMILES | CCCCn1c(C2CCC2)n[nH]c1=S |
| InChI | InChI=1S/C10H17N3S/c1-2-3-7-13-9(8-5-4-6-8)11-12-10(13)14/h8H,2-7H2,1H3,(H,12,14) |
| InChIKey | FTGNEUPRQWLMRL-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 33.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.33 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|