About 2,2-difluoro-3-(3-methyl-1,2-thiazol-5-yl)propanoic acid
2,2-difluoro-3-(3-methyl-1,2-thiazol-5-yl)propanoic acid (PubChem CID 165463783) has the molecular formula C7H7F2NO2S
and a molecular weight of 207.20 g/mol. Its IUPAC name is 2,2-difluoro-3-(3-methyl-1,2-thiazol-5-yl)propanoic acid.
Molecular Properties
| Compound Name | 2,2-difluoro-3-(3-methyl-1,2-thiazol-5-yl)propanoic acid |
| PubChem CID | 165463783 |
| Molecular Formula | C7H7F2NO2S |
| Molecular Weight | 207.20 g/mol |
| Exact Mass | 207.02 |
| IUPAC Name | 2,2-difluoro-3-(3-methyl-1,2-thiazol-5-yl)propanoic acid |
| SMILES | Cc1cc(CC(F)(F)C(=O)O)sn1 |
| InChI | InChI=1S/C7H7F2NO2S/c1-4-2-5(13-10-4)3-7(8,9)6(11)12/h2H,3H2,1H3,(H,11,12) |
| InChIKey | AKFSZIUDIKCFCV-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.20 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,2-difluoro-3-(3-methyl-1,2-thiazol-5-yl)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-difluoro-3-(3-methyl-1,2-thiazol-5-yl)propanoic acid?
The IUPAC name of 2,2-difluoro-3-(3-methyl-1,2-thiazol-5-yl)propanoic acid (CID 165463783) is 2,2-difluoro-3-(3-methyl-1,2-thiazol-5-yl)propanoic acid.
What is the SMILES notation for 2,2-difluoro-3-(3-methyl-1,2-thiazol-5-yl)propanoic acid?
The canonical SMILES for 2,2-difluoro-3-(3-methyl-1,2-thiazol-5-yl)propanoic acid is Cc1cc(CC(F)(F)C(=O)O)sn1.
What is the InChIKey of 2,2-difluoro-3-(3-methyl-1,2-thiazol-5-yl)propanoic acid?
The InChIKey is AKFSZIUDIKCFCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7F2NO2S/c1-4-2-5(13-10-4)3-7(8,9)6(11)12/h2H,3H2,1H3,(H,11,12).
What are the key properties of 2,2-difluoro-3-(3-methyl-1,2-thiazol-5-yl)propanoic acid?
2,2-difluoro-3-(3-methyl-1,2-thiazol-5-yl)propanoic acid has a molecular weight of 207.20 g/mol, XLogP of 1.71, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-difluoro-3-(3-methyl-1,2-thiazol-5-yl)propanoic acid is sourced from PubChem (CID 165463783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).