About 6-oxo-2-(3,3,3-trifluoropropyl)-1H-pyrimidine-4-carboxylic acid
6-oxo-2-(3,3,3-trifluoropropyl)-1H-pyrimidine-4-carboxylic acid (PubChem CID 165463939) has the molecular formula C8H7F3N2O3
and a molecular weight of 236.15 g/mol. Its IUPAC name is 6-oxo-2-(3,3,3-trifluoropropyl)-1H-pyrimidine-4-carboxylic acid.
Molecular Properties
| Compound Name | 6-oxo-2-(3,3,3-trifluoropropyl)-1H-pyrimidine-4-carboxylic acid |
| PubChem CID | 165463939 |
| Molecular Formula | C8H7F3N2O3 |
| Molecular Weight | 236.15 g/mol |
| Exact Mass | 236.04 |
| IUPAC Name | 6-oxo-2-(3,3,3-trifluoropropyl)-1H-pyrimidine-4-carboxylic acid |
| SMILES | O=C(O)c1cc(=O)[nH]c(CCC(F)(F)F)n1 |
| InChI | InChI=1S/C8H7F3N2O3/c9-8(10,11)2-1-5-12-4(7(15)16)3-6(14)13-5/h3H,1-2H2,(H,15,16)(H,12,13,14) |
| InChIKey | IWCGYFSQIGCANP-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 83.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.15 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-oxo-2-(3,3,3-trifluoropropyl)-1H-pyrimidine-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-oxo-2-(3,3,3-trifluoropropyl)-1H-pyrimidine-4-carboxylic acid?
The IUPAC name of 6-oxo-2-(3,3,3-trifluoropropyl)-1H-pyrimidine-4-carboxylic acid (CID 165463939) is 6-oxo-2-(3,3,3-trifluoropropyl)-1H-pyrimidine-4-carboxylic acid.
What is the SMILES notation for 6-oxo-2-(3,3,3-trifluoropropyl)-1H-pyrimidine-4-carboxylic acid?
The canonical SMILES for 6-oxo-2-(3,3,3-trifluoropropyl)-1H-pyrimidine-4-carboxylic acid is O=C(O)c1cc(=O)[nH]c(CCC(F)(F)F)n1.
What is the InChIKey of 6-oxo-2-(3,3,3-trifluoropropyl)-1H-pyrimidine-4-carboxylic acid?
The InChIKey is IWCGYFSQIGCANP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7F3N2O3/c9-8(10,11)2-1-5-12-4(7(15)16)3-6(14)13-5/h3H,1-2H2,(H,15,16)(H,12,13,14).
What are the key properties of 6-oxo-2-(3,3,3-trifluoropropyl)-1H-pyrimidine-4-carboxylic acid?
6-oxo-2-(3,3,3-trifluoropropyl)-1H-pyrimidine-4-carboxylic acid has a molecular weight of 236.15 g/mol, XLogP of 0.96, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-oxo-2-(3,3,3-trifluoropropyl)-1H-pyrimidine-4-carboxylic acid is sourced from PubChem (CID 165463939), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).