About tert-butyl (2R)-4,4-difluoro-2-prop-2-enoylpyrrolidine-1-carboxylate
tert-butyl (2R)-4,4-difluoro-2-prop-2-enoylpyrrolidine-1-carboxylate (PubChem CID 165463977) has the molecular formula C12H17F2NO3
and a molecular weight of 261.27 g/mol. Its IUPAC name is tert-butyl (2R)-4,4-difluoro-2-prop-2-enoylpyrrolidine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl (2R)-4,4-difluoro-2-prop-2-enoylpyrrolidine-1-carboxylate |
| PubChem CID | 165463977 |
| Molecular Formula | C12H17F2NO3 |
| Molecular Weight | 261.27 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | tert-butyl (2R)-4,4-difluoro-2-prop-2-enoylpyrrolidine-1-carboxylate |
| SMILES | C=CC(=O)[C@H]1CC(F)(F)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H17F2NO3/c1-5-9(16)8-6-12(13,14)7-15(8)10(17)18-11(2,3)4/h5,8H,1,6-7H2,2-4H3/t8-/m1/s1 |
| InChIKey | CBRIIGOUISUFCA-MRVPVSSYSA-N |
| XLogP | 2.39 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.27 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl (2R)-4,4-difluoro-2-prop-2-enoylpyrrolidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (2R)-4,4-difluoro-2-prop-2-enoylpyrrolidine-1-carboxylate?
The IUPAC name of tert-butyl (2R)-4,4-difluoro-2-prop-2-enoylpyrrolidine-1-carboxylate (CID 165463977) is tert-butyl (2R)-4,4-difluoro-2-prop-2-enoylpyrrolidine-1-carboxylate.
What is the SMILES notation for tert-butyl (2R)-4,4-difluoro-2-prop-2-enoylpyrrolidine-1-carboxylate?
The canonical SMILES for tert-butyl (2R)-4,4-difluoro-2-prop-2-enoylpyrrolidine-1-carboxylate is C=CC(=O)[C@H]1CC(F)(F)CN1C(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl (2R)-4,4-difluoro-2-prop-2-enoylpyrrolidine-1-carboxylate?
The InChIKey is CBRIIGOUISUFCA-MRVPVSSYSA-N. The full InChI is InChI=1S/C12H17F2NO3/c1-5-9(16)8-6-12(13,14)7-15(8)10(17)18-11(2,3)4/h5,8H,1,6-7H2,2-4H3/t8-/m1/s1.
What are the key properties of tert-butyl (2R)-4,4-difluoro-2-prop-2-enoylpyrrolidine-1-carboxylate?
tert-butyl (2R)-4,4-difluoro-2-prop-2-enoylpyrrolidine-1-carboxylate has a molecular weight of 261.27 g/mol, XLogP of 2.39, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (2R)-4,4-difluoro-2-prop-2-enoylpyrrolidine-1-carboxylate is sourced from PubChem (CID 165463977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).