C12H21BO2S — CID 165465545
4,4,5,5-tetramethyl-2-[(E)-2-(1-methylsulfanylcyclopropyl)ethenyl]-1,3,2-dioxaborolane (PubChem CID 165465545) has the molecular formula C12H21BO2S and a molecular weight of 240.18 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[(E)-2-(1-methylsulfanylcyclopropyl)ethenyl]-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[(E)-2-(1-methylsulfanylcyclopropyl)ethenyl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 165465545 |
| Molecular Formula | C12H21BO2S |
| Molecular Weight | 240.18 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[(E)-2-(1-methylsulfanylcyclopropyl)ethenyl]-1,3,2-dioxaborolane |
| SMILES | CSC1(/C=C/B2OC(C)(C)C(C)(C)O2)CC1 |
| InChI | InChI=1S/C12H21BO2S/c1-10(2)11(3,4)15-13(14-10)9-8-12(16-5)6-7-12/h8-9H,6-7H2,1-5H3/b9-8+ |
| InChIKey | UCYFFGAZGXSPPH-CMDGGOBGSA-N |
| XLogP | 3.07 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.18 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|