About 1-(propoxymethyl)-1,2,4-triazol-3-amine
1-(propoxymethyl)-1,2,4-triazol-3-amine (PubChem CID 165465664) has the molecular formula C6H12N4O
and a molecular weight of 156.19 g/mol. Its IUPAC name is 1-(propoxymethyl)-1,2,4-triazol-3-amine.
Molecular Properties
| Compound Name | 1-(propoxymethyl)-1,2,4-triazol-3-amine |
| PubChem CID | 165465664 |
| Molecular Formula | C6H12N4O |
| Molecular Weight | 156.19 g/mol |
| Exact Mass | 156.10 |
| IUPAC Name | 1-(propoxymethyl)-1,2,4-triazol-3-amine |
| SMILES | CCCOCn1cnc(N)n1 |
| InChI | InChI=1S/C6H12N4O/c1-2-3-11-5-10-4-8-6(7)9-10/h4H,2-3,5H2,1H3,(H2,7,9) |
| InChIKey | ZVMMHXFILCHGHI-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.19 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-(propoxymethyl)-1,2,4-triazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(propoxymethyl)-1,2,4-triazol-3-amine?
The IUPAC name of 1-(propoxymethyl)-1,2,4-triazol-3-amine (CID 165465664) is 1-(propoxymethyl)-1,2,4-triazol-3-amine.
What is the SMILES notation for 1-(propoxymethyl)-1,2,4-triazol-3-amine?
The canonical SMILES for 1-(propoxymethyl)-1,2,4-triazol-3-amine is CCCOCn1cnc(N)n1.
What is the InChIKey of 1-(propoxymethyl)-1,2,4-triazol-3-amine?
The InChIKey is ZVMMHXFILCHGHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N4O/c1-2-3-11-5-10-4-8-6(7)9-10/h4H,2-3,5H2,1H3,(H2,7,9).
What are the key properties of 1-(propoxymethyl)-1,2,4-triazol-3-amine?
1-(propoxymethyl)-1,2,4-triazol-3-amine has a molecular weight of 156.19 g/mol, XLogP of 0.24, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(propoxymethyl)-1,2,4-triazol-3-amine is sourced from PubChem (CID 165465664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).