C14H21BN2O3 — CID 165466315
2-cyclobutyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrimidin-6-one (PubChem CID 165466315) has the molecular formula C14H21BN2O3 and a molecular weight of 276.14 g/mol. Its IUPAC name is 2-cyclobutyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrimidin-6-one.
| Compound Name | 2-cyclobutyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 165466315 |
| Molecular Formula | C14H21BN2O3 |
| Molecular Weight | 276.14 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | 2-cyclobutyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrimidin-6-one |
| SMILES | CC1(C)OB(c2cnc(C3CCC3)[nH]c2=O)OC1(C)C |
| InChI | InChI=1S/C14H21BN2O3/c1-13(2)14(3,4)20-15(19-13)10-8-16-11(17-12(10)18)9-6-5-7-9/h8-9H,5-7H2,1-4H3,(H,16,17,18) |
| InChIKey | RRQWMXRRFXUWMB-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.14 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|