About 2,2-difluoro-3-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)propanoic acid
2,2-difluoro-3-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)propanoic acid (PubChem CID 165466454) has the molecular formula C9H13F2NO2
and a molecular weight of 205.20 g/mol. Its IUPAC name is 2,2-difluoro-3-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)propanoic acid.
Molecular Properties
| Compound Name | 2,2-difluoro-3-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)propanoic acid |
| PubChem CID | 165466454 |
| Molecular Formula | C9H13F2NO2 |
| Molecular Weight | 205.20 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | 2,2-difluoro-3-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)propanoic acid |
| SMILES | CC1=CCCN(CC(F)(F)C(=O)O)C1 |
| InChI | InChI=1S/C9H13F2NO2/c1-7-3-2-4-12(5-7)6-9(10,11)8(13)14/h3H,2,4-6H2,1H3,(H,13,14) |
| InChIKey | ITYPMEYZQJCERE-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.20 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2,2-difluoro-3-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-difluoro-3-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)propanoic acid?
The IUPAC name of 2,2-difluoro-3-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)propanoic acid (CID 165466454) is 2,2-difluoro-3-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)propanoic acid.
What is the SMILES notation for 2,2-difluoro-3-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)propanoic acid?
The canonical SMILES for 2,2-difluoro-3-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)propanoic acid is CC1=CCCN(CC(F)(F)C(=O)O)C1.
What is the InChIKey of 2,2-difluoro-3-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)propanoic acid?
The InChIKey is ITYPMEYZQJCERE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13F2NO2/c1-7-3-2-4-12(5-7)6-9(10,11)8(13)14/h3H,2,4-6H2,1H3,(H,13,14).
What are the key properties of 2,2-difluoro-3-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)propanoic acid?
2,2-difluoro-3-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)propanoic acid has a molecular weight of 205.20 g/mol, XLogP of 1.36, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-difluoro-3-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)propanoic acid is sourced from PubChem (CID 165466454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).