About 3-[(1-ethylazetidin-3-yl)amino]-2,2-difluoropropanoic acid
3-[(1-ethylazetidin-3-yl)amino]-2,2-difluoropropanoic acid (PubChem CID 165466734) has the molecular formula C8H14F2N2O2
and a molecular weight of 208.21 g/mol. Its IUPAC name is 3-[(1-ethylazetidin-3-yl)amino]-2,2-difluoropropanoic acid.
Molecular Properties
| Compound Name | 3-[(1-ethylazetidin-3-yl)amino]-2,2-difluoropropanoic acid |
| PubChem CID | 165466734 |
| Molecular Formula | C8H14F2N2O2 |
| Molecular Weight | 208.21 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | 3-[(1-ethylazetidin-3-yl)amino]-2,2-difluoropropanoic acid |
| SMILES | CCN1CC(NCC(F)(F)C(=O)O)C1 |
| InChI | InChI=1S/C8H14F2N2O2/c1-2-12-3-6(4-12)11-5-8(9,10)7(13)14/h6,11H,2-5H2,1H3,(H,13,14) |
| InChIKey | QCXUBZPBICKDAU-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.21 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[(1-ethylazetidin-3-yl)amino]-2,2-difluoropropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(1-ethylazetidin-3-yl)amino]-2,2-difluoropropanoic acid?
The IUPAC name of 3-[(1-ethylazetidin-3-yl)amino]-2,2-difluoropropanoic acid (CID 165466734) is 3-[(1-ethylazetidin-3-yl)amino]-2,2-difluoropropanoic acid.
What is the SMILES notation for 3-[(1-ethylazetidin-3-yl)amino]-2,2-difluoropropanoic acid?
The canonical SMILES for 3-[(1-ethylazetidin-3-yl)amino]-2,2-difluoropropanoic acid is CCN1CC(NCC(F)(F)C(=O)O)C1.
What is the InChIKey of 3-[(1-ethylazetidin-3-yl)amino]-2,2-difluoropropanoic acid?
The InChIKey is QCXUBZPBICKDAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14F2N2O2/c1-2-12-3-6(4-12)11-5-8(9,10)7(13)14/h6,11H,2-5H2,1H3,(H,13,14).
What are the key properties of 3-[(1-ethylazetidin-3-yl)amino]-2,2-difluoropropanoic acid?
3-[(1-ethylazetidin-3-yl)amino]-2,2-difluoropropanoic acid has a molecular weight of 208.21 g/mol, XLogP of 0.00, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1-ethylazetidin-3-yl)amino]-2,2-difluoropropanoic acid is sourced from PubChem (CID 165466734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).