C7H10F2N2O3 — CID 165466795
2,2-difluoro-3-(3-oxopiperazin-1-yl)propanoic acid (PubChem CID 165466795) has the molecular formula C7H10F2N2O3 and a molecular weight of 208.16 g/mol. Its IUPAC name is 2,2-difluoro-3-(3-oxopiperazin-1-yl)propanoic acid.
| Compound Name | 2,2-difluoro-3-(3-oxopiperazin-1-yl)propanoic acid |
|---|---|
| PubChem CID | 165466795 |
| Molecular Formula | C7H10F2N2O3 |
| Molecular Weight | 208.16 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | 2,2-difluoro-3-(3-oxopiperazin-1-yl)propanoic acid |
| SMILES | O=C1CN(CC(F)(F)C(=O)O)CCN1 |
| InChI | InChI=1S/C7H10F2N2O3/c8-7(9,6(13)14)4-11-2-1-10-5(12)3-11/h1-4H2,(H,10,12)(H,13,14) |
| InChIKey | RHEJKHRCTGTZIU-UHFFFAOYSA-N |
| XLogP | -0.86 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.16 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |