About sodium 4-(4-fluorophenyl)-5-methyl-1,3-thiazole-2-carboxylate
sodium 4-(4-fluorophenyl)-5-methyl-1,3-thiazole-2-carboxylate (PubChem CID 165467667) has the molecular formula C11H7FNNaO2S
and a molecular weight of 259.24 g/mol. Its IUPAC name is sodium 4-(4-fluorophenyl)-5-methyl-1,3-thiazole-2-carboxylate.
Molecular Properties
| Compound Name | sodium 4-(4-fluorophenyl)-5-methyl-1,3-thiazole-2-carboxylate |
| PubChem CID | 165467667 |
| Molecular Formula | C11H7FNNaO2S |
| Molecular Weight | 259.24 g/mol |
| Exact Mass | 259.01 |
| IUPAC Name | sodium 4-(4-fluorophenyl)-5-methyl-1,3-thiazole-2-carboxylate |
| SMILES | Cc1sc(C(=O)[O-])nc1-c1ccc(F)cc1.[Na+] |
| InChI | InChI=1S/C11H8FNO2S.Na/c1-6-9(13-10(16-6)11(14)15)7-2-4-8(12)5-3-7;/h2-5H,1H3,(H,14,15);/q;+1/p-1 |
| InChIKey | JIQUXJHBLHBWIU-UHFFFAOYSA-M |
| XLogP | -1.37 |
| TPSA | 53.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.24 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze sodium 4-(4-fluorophenyl)-5-methyl-1,3-thiazole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 4-(4-fluorophenyl)-5-methyl-1,3-thiazole-2-carboxylate?
The IUPAC name of sodium 4-(4-fluorophenyl)-5-methyl-1,3-thiazole-2-carboxylate (CID 165467667) is sodium 4-(4-fluorophenyl)-5-methyl-1,3-thiazole-2-carboxylate.
What is the SMILES notation for sodium 4-(4-fluorophenyl)-5-methyl-1,3-thiazole-2-carboxylate?
The canonical SMILES for sodium 4-(4-fluorophenyl)-5-methyl-1,3-thiazole-2-carboxylate is Cc1sc(C(=O)[O-])nc1-c1ccc(F)cc1.[Na+].
What is the InChIKey of sodium 4-(4-fluorophenyl)-5-methyl-1,3-thiazole-2-carboxylate?
The InChIKey is JIQUXJHBLHBWIU-UHFFFAOYSA-M. The full InChI is InChI=1S/C11H8FNO2S.Na/c1-6-9(13-10(16-6)11(14)15)7-2-4-8(12)5-3-7;/h2-5H,1H3,(H,14,15);/q;+1/p-1.
What are the key properties of sodium 4-(4-fluorophenyl)-5-methyl-1,3-thiazole-2-carboxylate?
sodium 4-(4-fluorophenyl)-5-methyl-1,3-thiazole-2-carboxylate has a molecular weight of 259.24 g/mol, XLogP of -1.37, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 4-(4-fluorophenyl)-5-methyl-1,3-thiazole-2-carboxylate is sourced from PubChem (CID 165467667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).