About 3-(5-bromo-1,3-thiazol-2-yl)oxetan-3-amine;hydrochloride
3-(5-bromo-1,3-thiazol-2-yl)oxetan-3-amine;hydrochloride (PubChem CID 165468833) has the molecular formula C6H8BrClN2OS
and a molecular weight of 271.57 g/mol. Its IUPAC name is 3-(5-bromo-1,3-thiazol-2-yl)oxetan-3-amine;hydrochloride.
Molecular Properties
| Compound Name | 3-(5-bromo-1,3-thiazol-2-yl)oxetan-3-amine;hydrochloride |
| PubChem CID | 165468833 |
| Molecular Formula | C6H8BrClN2OS |
| Molecular Weight | 271.57 g/mol |
| Exact Mass | 269.92 |
| IUPAC Name | 3-(5-bromo-1,3-thiazol-2-yl)oxetan-3-amine;hydrochloride |
| SMILES | Cl.NC1(c2ncc(Br)s2)COC1 |
| InChI | InChI=1S/C6H7BrN2OS.ClH/c7-4-1-9-5(11-4)6(8)2-10-3-6;/h1H,2-3,8H2;1H |
| InChIKey | OHPHDYLPXXWAPG-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.57 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(5-bromo-1,3-thiazol-2-yl)oxetan-3-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(5-bromo-1,3-thiazol-2-yl)oxetan-3-amine;hydrochloride?
The IUPAC name of 3-(5-bromo-1,3-thiazol-2-yl)oxetan-3-amine;hydrochloride (CID 165468833) is 3-(5-bromo-1,3-thiazol-2-yl)oxetan-3-amine;hydrochloride.
What is the SMILES notation for 3-(5-bromo-1,3-thiazol-2-yl)oxetan-3-amine;hydrochloride?
The canonical SMILES for 3-(5-bromo-1,3-thiazol-2-yl)oxetan-3-amine;hydrochloride is Cl.NC1(c2ncc(Br)s2)COC1.
What is the InChIKey of 3-(5-bromo-1,3-thiazol-2-yl)oxetan-3-amine;hydrochloride?
The InChIKey is OHPHDYLPXXWAPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7BrN2OS.ClH/c7-4-1-9-5(11-4)6(8)2-10-3-6;/h1H,2-3,8H2;1H.
What are the key properties of 3-(5-bromo-1,3-thiazol-2-yl)oxetan-3-amine;hydrochloride?
3-(5-bromo-1,3-thiazol-2-yl)oxetan-3-amine;hydrochloride has a molecular weight of 271.57 g/mol, XLogP of 1.51, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5-bromo-1,3-thiazol-2-yl)oxetan-3-amine;hydrochloride is sourced from PubChem (CID 165468833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).