About cis-(1R,2R)-2-(sulfamoylmethyl)cyclopropane-1-carboxamide
cis-(1R,2R)-2-(sulfamoylmethyl)cyclopropane-1-carboxamide (PubChem CID 165469584) has the molecular formula C5H10N2O3S
and a molecular weight of 178.21 g/mol. Its IUPAC name is cis-(1R,2R)-2-(sulfamoylmethyl)cyclopropane-1-carboxamide.
Molecular Properties
| Compound Name | cis-(1R,2R)-2-(sulfamoylmethyl)cyclopropane-1-carboxamide |
| PubChem CID | 165469584 |
| Molecular Formula | C5H10N2O3S |
| Molecular Weight | 178.21 g/mol |
| Exact Mass | 178.04 |
| IUPAC Name | cis-(1R,2R)-2-(sulfamoylmethyl)cyclopropane-1-carboxamide |
| SMILES | NC(=O)[C@@H]1C[C@H]1CS(N)(=O)=O |
| InChI | InChI=1S/C5H10N2O3S/c6-5(8)4-1-3(4)2-11(7,9)10/h3-4H,1-2H2,(H2,6,8)(H2,7,9,10)/t3-,4+/m0/s1 |
| InChIKey | AKBHWLNKXLHYQT-IUYQGCFVSA-N |
| XLogP | -1.60 |
| TPSA | 103.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.21 |
| LogP ≤ 5 | -1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze cis-(1R,2R)-2-(sulfamoylmethyl)cyclopropane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(1R,2R)-2-(sulfamoylmethyl)cyclopropane-1-carboxamide?
The IUPAC name of cis-(1R,2R)-2-(sulfamoylmethyl)cyclopropane-1-carboxamide (CID 165469584) is cis-(1R,2R)-2-(sulfamoylmethyl)cyclopropane-1-carboxamide.
What is the SMILES notation for cis-(1R,2R)-2-(sulfamoylmethyl)cyclopropane-1-carboxamide?
The canonical SMILES for cis-(1R,2R)-2-(sulfamoylmethyl)cyclopropane-1-carboxamide is NC(=O)[C@@H]1C[C@H]1CS(N)(=O)=O.
What is the InChIKey of cis-(1R,2R)-2-(sulfamoylmethyl)cyclopropane-1-carboxamide?
The InChIKey is AKBHWLNKXLHYQT-IUYQGCFVSA-N. The full InChI is InChI=1S/C5H10N2O3S/c6-5(8)4-1-3(4)2-11(7,9)10/h3-4H,1-2H2,(H2,6,8)(H2,7,9,10)/t3-,4+/m0/s1.
What are the key properties of cis-(1R,2R)-2-(sulfamoylmethyl)cyclopropane-1-carboxamide?
cis-(1R,2R)-2-(sulfamoylmethyl)cyclopropane-1-carboxamide has a molecular weight of 178.21 g/mol, XLogP of -1.60, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(1R,2R)-2-(sulfamoylmethyl)cyclopropane-1-carboxamide is sourced from PubChem (CID 165469584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).