C9H16FN3 — CID 165470187
N-[[1-(2-fluoroethyl)pyrazol-3-yl]methyl]propan-2-amine (PubChem CID 165470187) has the molecular formula C9H16FN3 and a molecular weight of 185.25 g/mol. Its IUPAC name is N-[[1-(2-fluoroethyl)pyrazol-3-yl]methyl]propan-2-amine.
| Compound Name | N-[[1-(2-fluoroethyl)pyrazol-3-yl]methyl]propan-2-amine |
|---|---|
| PubChem CID | 165470187 |
| Molecular Formula | C9H16FN3 |
| Molecular Weight | 185.25 g/mol |
| Exact Mass | 185.13 |
| IUPAC Name | N-[[1-(2-fluoroethyl)pyrazol-3-yl]methyl]propan-2-amine |
| SMILES | CC(C)NCc1ccn(CCF)n1 |
| InChI | InChI=1S/C9H16FN3/c1-8(2)11-7-9-3-5-13(12-9)6-4-10/h3,5,8,11H,4,6-7H2,1-2H3 |
| InChIKey | VJAGIWYCMBWOCB-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.25 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |