About [1-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)ethyl]pyrazol-4-yl]methanol
[1-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)ethyl]pyrazol-4-yl]methanol (PubChem CID 165470394) has the molecular formula C11H18N2O3
and a molecular weight of 226.28 g/mol. Its IUPAC name is [1-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)ethyl]pyrazol-4-yl]methanol.
Molecular Properties
| Compound Name | [1-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)ethyl]pyrazol-4-yl]methanol |
| PubChem CID | 165470394 |
| Molecular Formula | C11H18N2O3 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | [1-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)ethyl]pyrazol-4-yl]methanol |
| SMILES | CC1(C)OCC(CCn2cc(CO)cn2)O1 |
| InChI | InChI=1S/C11H18N2O3/c1-11(2)15-8-10(16-11)3-4-13-6-9(7-14)5-12-13/h5-6,10,14H,3-4,7-8H2,1-2H3 |
| InChIKey | QMROHEDKUWHIKM-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [1-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)ethyl]pyrazol-4-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)ethyl]pyrazol-4-yl]methanol?
The IUPAC name of [1-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)ethyl]pyrazol-4-yl]methanol (CID 165470394) is [1-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)ethyl]pyrazol-4-yl]methanol.
What is the SMILES notation for [1-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)ethyl]pyrazol-4-yl]methanol?
The canonical SMILES for [1-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)ethyl]pyrazol-4-yl]methanol is CC1(C)OCC(CCn2cc(CO)cn2)O1.
What is the InChIKey of [1-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)ethyl]pyrazol-4-yl]methanol?
The InChIKey is QMROHEDKUWHIKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2O3/c1-11(2)15-8-10(16-11)3-4-13-6-9(7-14)5-12-13/h5-6,10,14H,3-4,7-8H2,1-2H3.
What are the key properties of [1-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)ethyl]pyrazol-4-yl]methanol?
[1-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)ethyl]pyrazol-4-yl]methanol has a molecular weight of 226.28 g/mol, XLogP of 0.92, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)ethyl]pyrazol-4-yl]methanol is sourced from PubChem (CID 165470394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).