About 2,3-dihydroimidazo[2,1-b][1,3]thiazol-5-ylmethanol
2,3-dihydroimidazo[2,1-b][1,3]thiazol-5-ylmethanol (PubChem CID 165470556) has the molecular formula C6H8N2OS
and a molecular weight of 156.21 g/mol. Its IUPAC name is 2,3-dihydroimidazo[2,1-b][1,3]thiazol-5-ylmethanol.
Analyze 2,3-dihydroimidazo[2,1-b][1,3]thiazol-5-ylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydroimidazo[2,1-b][1,3]thiazol-5-ylmethanol?
The IUPAC name of 2,3-dihydroimidazo[2,1-b][1,3]thiazol-5-ylmethanol (CID 165470556) is 2,3-dihydroimidazo[2,1-b][1,3]thiazol-5-ylmethanol.
What is the SMILES notation for 2,3-dihydroimidazo[2,1-b][1,3]thiazol-5-ylmethanol?
The canonical SMILES for 2,3-dihydroimidazo[2,1-b][1,3]thiazol-5-ylmethanol is OCc1cnc2n1CCS2.
What is the InChIKey of 2,3-dihydroimidazo[2,1-b][1,3]thiazol-5-ylmethanol?
The InChIKey is LECJYNGGRFQKAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2OS/c9-4-5-3-7-6-8(5)1-2-10-6/h3,9H,1-2,4H2.
What are the key properties of 2,3-dihydroimidazo[2,1-b][1,3]thiazol-5-ylmethanol?
2,3-dihydroimidazo[2,1-b][1,3]thiazol-5-ylmethanol has a molecular weight of 156.21 g/mol, XLogP of 0.48, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydroimidazo[2,1-b][1,3]thiazol-5-ylmethanol is sourced from PubChem (CID 165470556), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).