C11H17NS — CID 165470562
7,7-diethyl-5,6-dihydro-4H-thieno[2,3-c]pyridine (PubChem CID 165470562) has the molecular formula C11H17NS and a molecular weight of 195.33 g/mol. Its IUPAC name is 7,7-diethyl-5,6-dihydro-4H-thieno[2,3-c]pyridine.
| Compound Name | 7,7-diethyl-5,6-dihydro-4H-thieno[2,3-c]pyridine |
|---|---|
| PubChem CID | 165470562 |
| Molecular Formula | C11H17NS |
| Molecular Weight | 195.33 g/mol |
| Exact Mass | 195.11 |
| IUPAC Name | 7,7-diethyl-5,6-dihydro-4H-thieno[2,3-c]pyridine |
| SMILES | CCC1(CC)NCCc2ccsc21 |
| InChI | InChI=1S/C11H17NS/c1-3-11(4-2)10-9(5-7-12-11)6-8-13-10/h6,8,12H,3-5,7H2,1-2H3 |
| InChIKey | VSLZQQAJQIYZOP-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.33 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |