C13H21BN2O2 — CID 165471187
1,3-dimethyl-5-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]pyrazole (PubChem CID 165471187) has the molecular formula C13H21BN2O2 and a molecular weight of 248.13 g/mol. Its IUPAC name is 1,3-dimethyl-5-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]pyrazole.
| Compound Name | 1,3-dimethyl-5-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]pyrazole |
|---|---|
| PubChem CID | 165471187 |
| Molecular Formula | C13H21BN2O2 |
| Molecular Weight | 248.13 g/mol |
| Exact Mass | 248.17 |
| IUPAC Name | 1,3-dimethyl-5-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]pyrazole |
| SMILES | Cc1cc(/C=C/B2OC(C)(C)C(C)(C)O2)n(C)n1 |
| InChI | InChI=1S/C13H21BN2O2/c1-10-9-11(16(6)15-10)7-8-14-17-12(2,3)13(4,5)18-14/h7-9H,1-6H3/b8-7+ |
| InChIKey | LVCQGGXYHCMBST-BQYQJAHWSA-N |
| XLogP | 2.37 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.13 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|