About 5-bromo-1-[1-(dimethylamino)propan-2-yl]-1,2,4-triazol-3-amine
5-bromo-1-[1-(dimethylamino)propan-2-yl]-1,2,4-triazol-3-amine (PubChem CID 165472120) has the molecular formula C7H14BrN5
and a molecular weight of 248.13 g/mol. Its IUPAC name is 5-bromo-1-[1-(dimethylamino)propan-2-yl]-1,2,4-triazol-3-amine.
Molecular Properties
| Compound Name | 5-bromo-1-[1-(dimethylamino)propan-2-yl]-1,2,4-triazol-3-amine |
| PubChem CID | 165472120 |
| Molecular Formula | C7H14BrN5 |
| Molecular Weight | 248.13 g/mol |
| Exact Mass | 247.04 |
| IUPAC Name | 5-bromo-1-[1-(dimethylamino)propan-2-yl]-1,2,4-triazol-3-amine |
| SMILES | CC(CN(C)C)n1nc(N)nc1Br |
| InChI | InChI=1S/C7H14BrN5/c1-5(4-12(2)3)13-6(8)10-7(9)11-13/h5H,4H2,1-3H3,(H2,9,11) |
| InChIKey | OXSGYEUQEFJDLM-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.13 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-bromo-1-[1-(dimethylamino)propan-2-yl]-1,2,4-triazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-1-[1-(dimethylamino)propan-2-yl]-1,2,4-triazol-3-amine?
The IUPAC name of 5-bromo-1-[1-(dimethylamino)propan-2-yl]-1,2,4-triazol-3-amine (CID 165472120) is 5-bromo-1-[1-(dimethylamino)propan-2-yl]-1,2,4-triazol-3-amine.
What is the SMILES notation for 5-bromo-1-[1-(dimethylamino)propan-2-yl]-1,2,4-triazol-3-amine?
The canonical SMILES for 5-bromo-1-[1-(dimethylamino)propan-2-yl]-1,2,4-triazol-3-amine is CC(CN(C)C)n1nc(N)nc1Br.
What is the InChIKey of 5-bromo-1-[1-(dimethylamino)propan-2-yl]-1,2,4-triazol-3-amine?
The InChIKey is OXSGYEUQEFJDLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14BrN5/c1-5(4-12(2)3)13-6(8)10-7(9)11-13/h5H,4H2,1-3H3,(H2,9,11).
What are the key properties of 5-bromo-1-[1-(dimethylamino)propan-2-yl]-1,2,4-triazol-3-amine?
5-bromo-1-[1-(dimethylamino)propan-2-yl]-1,2,4-triazol-3-amine has a molecular weight of 248.13 g/mol, XLogP of 0.75, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-1-[1-(dimethylamino)propan-2-yl]-1,2,4-triazol-3-amine is sourced from PubChem (CID 165472120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).