methyl (E)-4-(4-methylsulfonylpyrazol-1-yl)but-2-enoate

C9H12N2O4S — CID 165472264

IUPACmethyl (E)-4-(4-methylsulfonylpyrazol-1-yl)but-2-enoate
SMILESCOC(=O)/C=C/Cn1cc(S(C)(=O)=O)cn1
InChIInChI=1S/C9H12N2O4S/c1-15-9(12)4-3-5-11-7-8(6-10-11)16(2,13)14/h3-4,6-7H,5H2,1-2H3/b4-3+
InChIKeyFVVBJDBJLXZTGQ-ONEGZZNKSA-N
MW244.27 g/mol
LogP0.02
Rot. Bonds4

About methyl (E)-4-(4-methylsulfonylpyrazol-1-yl)but-2-enoate

methyl (E)-4-(4-methylsulfonylpyrazol-1-yl)but-2-enoate (PubChem CID 165472264) has the molecular formula C9H12N2O4S and a molecular weight of 244.27 g/mol. Its IUPAC name is methyl (E)-4-(4-methylsulfonylpyrazol-1-yl)but-2-enoate.

Molecular Properties

Compound Namemethyl (E)-4-(4-methylsulfonylpyrazol-1-yl)but-2-enoate
PubChem CID165472264
Molecular FormulaC9H12N2O4S
Molecular Weight244.27 g/mol
Exact Mass244.05
IUPAC Namemethyl (E)-4-(4-methylsulfonylpyrazol-1-yl)but-2-enoate
SMILESCOC(=O)/C=C/Cn1cc(S(C)(=O)=O)cn1
InChIInChI=1S/C9H12N2O4S/c1-15-9(12)4-3-5-11-7-8(6-10-11)16(2,13)14/h3-4,6-7H,5H2,1-2H3/b4-3+
InChIKeyFVVBJDBJLXZTGQ-ONEGZZNKSA-N
XLogP0.02
TPSA78.26 Ų
H-Bond Donors
H-Bond Acceptors6
Rotatable Bonds4
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500244.27
LogP ≤ 50.02
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze methyl (E)-4-(4-methylsulfonylpyrazol-1-yl)but-2-enoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl (E)-4-(4-methylsulfonylpyrazol-1-yl)but-2-enoate?
The IUPAC name of methyl (E)-4-(4-methylsulfonylpyrazol-1-yl)but-2-enoate (CID 165472264) is methyl (E)-4-(4-methylsulfonylpyrazol-1-yl)but-2-enoate.
What is the SMILES notation for methyl (E)-4-(4-methylsulfonylpyrazol-1-yl)but-2-enoate?
The canonical SMILES for methyl (E)-4-(4-methylsulfonylpyrazol-1-yl)but-2-enoate is COC(=O)/C=C/Cn1cc(S(C)(=O)=O)cn1.
What is the InChIKey of methyl (E)-4-(4-methylsulfonylpyrazol-1-yl)but-2-enoate?
The InChIKey is FVVBJDBJLXZTGQ-ONEGZZNKSA-N. The full InChI is InChI=1S/C9H12N2O4S/c1-15-9(12)4-3-5-11-7-8(6-10-11)16(2,13)14/h3-4,6-7H,5H2,1-2H3/b4-3+.
What are the key properties of methyl (E)-4-(4-methylsulfonylpyrazol-1-yl)but-2-enoate?
methyl (E)-4-(4-methylsulfonylpyrazol-1-yl)but-2-enoate has a molecular weight of 244.27 g/mol, XLogP of 0.02, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (E)-4-(4-methylsulfonylpyrazol-1-yl)but-2-enoate is sourced from PubChem (CID 165472264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).