About 3-chloro-5,6-difluoro-1,2-benzothiazole
3-chloro-5,6-difluoro-1,2-benzothiazole (PubChem CID 165472697) has the molecular formula C7H2ClF2NS
and a molecular weight of 205.62 g/mol. Its IUPAC name is 3-chloro-5,6-difluoro-1,2-benzothiazole.
Molecular Properties
| Compound Name | 3-chloro-5,6-difluoro-1,2-benzothiazole |
| PubChem CID | 165472697 |
| Molecular Formula | C7H2ClF2NS |
| Molecular Weight | 205.62 g/mol |
| Exact Mass | 204.96 |
| IUPAC Name | 3-chloro-5,6-difluoro-1,2-benzothiazole |
| SMILES | Fc1cc2snc(Cl)c2cc1F |
| InChI | InChI=1S/C7H2ClF2NS/c8-7-3-1-4(9)5(10)2-6(3)12-11-7/h1-2H |
| InChIKey | FLPLWURVMASBJU-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.62 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-chloro-5,6-difluoro-1,2-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-5,6-difluoro-1,2-benzothiazole?
The IUPAC name of 3-chloro-5,6-difluoro-1,2-benzothiazole (CID 165472697) is 3-chloro-5,6-difluoro-1,2-benzothiazole.
What is the SMILES notation for 3-chloro-5,6-difluoro-1,2-benzothiazole?
The canonical SMILES for 3-chloro-5,6-difluoro-1,2-benzothiazole is Fc1cc2snc(Cl)c2cc1F.
What is the InChIKey of 3-chloro-5,6-difluoro-1,2-benzothiazole?
The InChIKey is FLPLWURVMASBJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H2ClF2NS/c8-7-3-1-4(9)5(10)2-6(3)12-11-7/h1-2H.
What are the key properties of 3-chloro-5,6-difluoro-1,2-benzothiazole?
3-chloro-5,6-difluoro-1,2-benzothiazole has a molecular weight of 205.62 g/mol, XLogP of 3.23, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-5,6-difluoro-1,2-benzothiazole is sourced from PubChem (CID 165472697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).