About 5-amino-1-(4,4-difluoro-2-methylbutyl)pyridin-2-one
5-amino-1-(4,4-difluoro-2-methylbutyl)pyridin-2-one (PubChem CID 165472725) has the molecular formula C10H14F2N2O
and a molecular weight of 216.23 g/mol. Its IUPAC name is 5-amino-1-(4,4-difluoro-2-methylbutyl)pyridin-2-one.
Molecular Properties
| Compound Name | 5-amino-1-(4,4-difluoro-2-methylbutyl)pyridin-2-one |
| PubChem CID | 165472725 |
| Molecular Formula | C10H14F2N2O |
| Molecular Weight | 216.23 g/mol |
| Exact Mass | 216.11 |
| IUPAC Name | 5-amino-1-(4,4-difluoro-2-methylbutyl)pyridin-2-one |
| SMILES | CC(CC(F)F)Cn1cc(N)ccc1=O |
| InChI | InChI=1S/C10H14F2N2O/c1-7(4-9(11)12)5-14-6-8(13)2-3-10(14)15/h2-3,6-7,9H,4-5,13H2,1H3 |
| InChIKey | MHJXDOQIWAGGGL-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.23 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-amino-1-(4,4-difluoro-2-methylbutyl)pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-1-(4,4-difluoro-2-methylbutyl)pyridin-2-one?
The IUPAC name of 5-amino-1-(4,4-difluoro-2-methylbutyl)pyridin-2-one (CID 165472725) is 5-amino-1-(4,4-difluoro-2-methylbutyl)pyridin-2-one.
What is the SMILES notation for 5-amino-1-(4,4-difluoro-2-methylbutyl)pyridin-2-one?
The canonical SMILES for 5-amino-1-(4,4-difluoro-2-methylbutyl)pyridin-2-one is CC(CC(F)F)Cn1cc(N)ccc1=O.
What is the InChIKey of 5-amino-1-(4,4-difluoro-2-methylbutyl)pyridin-2-one?
The InChIKey is MHJXDOQIWAGGGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14F2N2O/c1-7(4-9(11)12)5-14-6-8(13)2-3-10(14)15/h2-3,6-7,9H,4-5,13H2,1H3.
What are the key properties of 5-amino-1-(4,4-difluoro-2-methylbutyl)pyridin-2-one?
5-amino-1-(4,4-difluoro-2-methylbutyl)pyridin-2-one has a molecular weight of 216.23 g/mol, XLogP of 1.72, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-1-(4,4-difluoro-2-methylbutyl)pyridin-2-one is sourced from PubChem (CID 165472725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).