C9H14ClF2N3 — CID 165472775
4-chloro-1-(2-ethyl-4,4-difluorobutyl)pyrazol-3-amine (PubChem CID 165472775) has the molecular formula C9H14ClF2N3 and a molecular weight of 237.68 g/mol. Its IUPAC name is 4-chloro-1-(2-ethyl-4,4-difluorobutyl)pyrazol-3-amine.
| Compound Name | 4-chloro-1-(2-ethyl-4,4-difluorobutyl)pyrazol-3-amine |
|---|---|
| PubChem CID | 165472775 |
| Molecular Formula | C9H14ClF2N3 |
| Molecular Weight | 237.68 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | 4-chloro-1-(2-ethyl-4,4-difluorobutyl)pyrazol-3-amine |
| SMILES | CCC(CC(F)F)Cn1cc(Cl)c(N)n1 |
| InChI | InChI=1S/C9H14ClF2N3/c1-2-6(3-8(11)12)4-15-5-7(10)9(13)14-15/h5-6,8H,2-4H2,1H3,(H2,13,14) |
| InChIKey | TUXUXGCXGNVFSE-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.68 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |