About 1-[[(1R,2R)-2-ethylcyclopropyl]methyl]triazol-4-amine
1-[[(1R,2R)-2-ethylcyclopropyl]methyl]triazol-4-amine (PubChem CID 165472993) has the molecular formula C8H14N4
and a molecular weight of 166.23 g/mol. Its IUPAC name is 1-[[(1R,2R)-2-ethylcyclopropyl]methyl]triazol-4-amine.
Molecular Properties
| Compound Name | 1-[[(1R,2R)-2-ethylcyclopropyl]methyl]triazol-4-amine |
| PubChem CID | 165472993 |
| Molecular Formula | C8H14N4 |
| Molecular Weight | 166.23 g/mol |
| Exact Mass | 166.12 |
| IUPAC Name | 1-[[(1R,2R)-2-ethylcyclopropyl]methyl]triazol-4-amine |
| SMILES | CC[C@@H]1C[C@H]1Cn1cc(N)nn1 |
| InChI | InChI=1S/C8H14N4/c1-2-6-3-7(6)4-12-5-8(9)10-11-12/h5-7H,2-4,9H2,1H3/t6-,7+/m1/s1 |
| InChIKey | PZVZQKPZUSQNSY-RQJHMYQMSA-N |
| XLogP | 0.91 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.23 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[[(1R,2R)-2-ethylcyclopropyl]methyl]triazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[(1R,2R)-2-ethylcyclopropyl]methyl]triazol-4-amine?
The IUPAC name of 1-[[(1R,2R)-2-ethylcyclopropyl]methyl]triazol-4-amine (CID 165472993) is 1-[[(1R,2R)-2-ethylcyclopropyl]methyl]triazol-4-amine.
What is the SMILES notation for 1-[[(1R,2R)-2-ethylcyclopropyl]methyl]triazol-4-amine?
The canonical SMILES for 1-[[(1R,2R)-2-ethylcyclopropyl]methyl]triazol-4-amine is CC[C@@H]1C[C@H]1Cn1cc(N)nn1.
What is the InChIKey of 1-[[(1R,2R)-2-ethylcyclopropyl]methyl]triazol-4-amine?
The InChIKey is PZVZQKPZUSQNSY-RQJHMYQMSA-N. The full InChI is InChI=1S/C8H14N4/c1-2-6-3-7(6)4-12-5-8(9)10-11-12/h5-7H,2-4,9H2,1H3/t6-,7+/m1/s1.
What are the key properties of 1-[[(1R,2R)-2-ethylcyclopropyl]methyl]triazol-4-amine?
1-[[(1R,2R)-2-ethylcyclopropyl]methyl]triazol-4-amine has a molecular weight of 166.23 g/mol, XLogP of 0.91, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[(1R,2R)-2-ethylcyclopropyl]methyl]triazol-4-amine is sourced from PubChem (CID 165472993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).