C13H19ClN2SSi — CID 165473185
2-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methylsulfanyl]ethyl-trimethylsilane (PubChem CID 165473185) has the molecular formula C13H19ClN2SSi and a molecular weight of 298.92 g/mol. Its IUPAC name is 2-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methylsulfanyl]ethyl-trimethylsilane.
| Compound Name | 2-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methylsulfanyl]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 165473185 |
| Molecular Formula | C13H19ClN2SSi |
| Molecular Weight | 298.92 g/mol |
| Exact Mass | 298.07 |
| IUPAC Name | 2-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methylsulfanyl]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCSCc1cn2cc(Cl)ccc2n1 |
| InChI | InChI=1S/C13H19ClN2SSi/c1-18(2,3)7-6-17-10-12-9-16-8-11(14)4-5-13(16)15-12/h4-5,8-9H,6-7,10H2,1-3H3 |
| InChIKey | CEQILNQCXJXFCB-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.92 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|