C16H12Cl3N3OS — CID 16547352
[2-(2-methylphenyl)imino-1,3-thiazolidin-3-yl]-(3,4,5-trichloro-2-pyridinyl)methanone (PubChem CID 16547352) has the molecular formula C16H12Cl3N3OS and a molecular weight of 400.72 g/mol. Its IUPAC name is [2-(2-methylphenyl)imino-1,3-thiazolidin-3-yl]-(3,4,5-trichloro-2-pyridinyl)methanone.
| Compound Name | [2-(2-methylphenyl)imino-1,3-thiazolidin-3-yl]-(3,4,5-trichloro-2-pyridinyl)methanone |
|---|---|
| PubChem CID | 16547352 |
| Molecular Formula | C16H12Cl3N3OS |
| Molecular Weight | 400.72 g/mol |
| Exact Mass | 398.98 |
| IUPAC Name | [2-(2-methylphenyl)imino-1,3-thiazolidin-3-yl]-(3,4,5-trichloro-2-pyridinyl)methanone |
| SMILES | Cc1ccccc1/N=C1\SCCN1C(=O)c1ncc(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C16H12Cl3N3OS/c1-9-4-2-3-5-11(9)21-16-22(6-7-24-16)15(23)14-13(19)12(18)10(17)8-20-14/h2-5,8H,6-7H2,1H3/b21-16- |
| InChIKey | DTLVMOCBWDRXSV-PGMHBOJBSA-N |
| XLogP | 5.23 |
| TPSA | 45.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.72 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|