About 5-methyl-1-[(4-methyl-1,2,4-triazol-3-yl)methyl]pyrazol-3-amine
5-methyl-1-[(4-methyl-1,2,4-triazol-3-yl)methyl]pyrazol-3-amine (PubChem CID 165473765) has the molecular formula C8H12N6
and a molecular weight of 192.23 g/mol. Its IUPAC name is 5-methyl-1-[(4-methyl-1,2,4-triazol-3-yl)methyl]pyrazol-3-amine.
Molecular Properties
| Compound Name | 5-methyl-1-[(4-methyl-1,2,4-triazol-3-yl)methyl]pyrazol-3-amine |
| PubChem CID | 165473765 |
| Molecular Formula | C8H12N6 |
| Molecular Weight | 192.23 g/mol |
| Exact Mass | 192.11 |
| IUPAC Name | 5-methyl-1-[(4-methyl-1,2,4-triazol-3-yl)methyl]pyrazol-3-amine |
| SMILES | Cc1cc(N)nn1Cc1nncn1C |
| InChI | InChI=1S/C8H12N6/c1-6-3-7(9)12-14(6)4-8-11-10-5-13(8)2/h3,5H,4H2,1-2H3,(H2,9,12) |
| InChIKey | LJIDRWITGUGRIF-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 74.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.23 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-methyl-1-[(4-methyl-1,2,4-triazol-3-yl)methyl]pyrazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-1-[(4-methyl-1,2,4-triazol-3-yl)methyl]pyrazol-3-amine?
The IUPAC name of 5-methyl-1-[(4-methyl-1,2,4-triazol-3-yl)methyl]pyrazol-3-amine (CID 165473765) is 5-methyl-1-[(4-methyl-1,2,4-triazol-3-yl)methyl]pyrazol-3-amine.
What is the SMILES notation for 5-methyl-1-[(4-methyl-1,2,4-triazol-3-yl)methyl]pyrazol-3-amine?
The canonical SMILES for 5-methyl-1-[(4-methyl-1,2,4-triazol-3-yl)methyl]pyrazol-3-amine is Cc1cc(N)nn1Cc1nncn1C.
What is the InChIKey of 5-methyl-1-[(4-methyl-1,2,4-triazol-3-yl)methyl]pyrazol-3-amine?
The InChIKey is LJIDRWITGUGRIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N6/c1-6-3-7(9)12-14(6)4-8-11-10-5-13(8)2/h3,5H,4H2,1-2H3,(H2,9,12).
What are the key properties of 5-methyl-1-[(4-methyl-1,2,4-triazol-3-yl)methyl]pyrazol-3-amine?
5-methyl-1-[(4-methyl-1,2,4-triazol-3-yl)methyl]pyrazol-3-amine has a molecular weight of 192.23 g/mol, XLogP of -0.05, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-1-[(4-methyl-1,2,4-triazol-3-yl)methyl]pyrazol-3-amine is sourced from PubChem (CID 165473765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).