About 3-(3-amino-1,2,4-triazol-1-yl)piperidin-2-one
3-(3-amino-1,2,4-triazol-1-yl)piperidin-2-one (PubChem CID 165473824) has the molecular formula C7H11N5O
and a molecular weight of 181.20 g/mol. Its IUPAC name is 3-(3-amino-1,2,4-triazol-1-yl)piperidin-2-one.
Molecular Properties
| Compound Name | 3-(3-amino-1,2,4-triazol-1-yl)piperidin-2-one |
| PubChem CID | 165473824 |
| Molecular Formula | C7H11N5O |
| Molecular Weight | 181.20 g/mol |
| Exact Mass | 181.10 |
| IUPAC Name | 3-(3-amino-1,2,4-triazol-1-yl)piperidin-2-one |
| SMILES | Nc1ncn(C2CCCNC2=O)n1 |
| InChI | InChI=1S/C7H11N5O/c8-7-10-4-12(11-7)5-2-1-3-9-6(5)13/h4-5H,1-3H2,(H2,8,11)(H,9,13) |
| InChIKey | RWHVSYSBSRMESD-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.20 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(3-amino-1,2,4-triazol-1-yl)piperidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-amino-1,2,4-triazol-1-yl)piperidin-2-one?
The IUPAC name of 3-(3-amino-1,2,4-triazol-1-yl)piperidin-2-one (CID 165473824) is 3-(3-amino-1,2,4-triazol-1-yl)piperidin-2-one.
What is the SMILES notation for 3-(3-amino-1,2,4-triazol-1-yl)piperidin-2-one?
The canonical SMILES for 3-(3-amino-1,2,4-triazol-1-yl)piperidin-2-one is Nc1ncn(C2CCCNC2=O)n1.
What is the InChIKey of 3-(3-amino-1,2,4-triazol-1-yl)piperidin-2-one?
The InChIKey is RWHVSYSBSRMESD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N5O/c8-7-10-4-12(11-7)5-2-1-3-9-6(5)13/h4-5H,1-3H2,(H2,8,11)(H,9,13).
What are the key properties of 3-(3-amino-1,2,4-triazol-1-yl)piperidin-2-one?
3-(3-amino-1,2,4-triazol-1-yl)piperidin-2-one has a molecular weight of 181.20 g/mol, XLogP of -0.69, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-amino-1,2,4-triazol-1-yl)piperidin-2-one is sourced from PubChem (CID 165473824), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).