About N-(2-aminoethyl)-N'-[2-(azetidin-3-yl)pyrazol-3-yl]oxamide
N-(2-aminoethyl)-N'-[2-(azetidin-3-yl)pyrazol-3-yl]oxamide (PubChem CID 165474686) has the molecular formula C10H16N6O2
and a molecular weight of 252.28 g/mol. Its IUPAC name is N-(2-aminoethyl)-N'-[2-(azetidin-3-yl)pyrazol-3-yl]oxamide.
Molecular Properties
| Compound Name | N-(2-aminoethyl)-N'-[2-(azetidin-3-yl)pyrazol-3-yl]oxamide |
| PubChem CID | 165474686 |
| Molecular Formula | C10H16N6O2 |
| Molecular Weight | 252.28 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | N-(2-aminoethyl)-N'-[2-(azetidin-3-yl)pyrazol-3-yl]oxamide |
| SMILES | NCCNC(=O)C(=O)Nc1ccnn1C1CNC1 |
| InChI | InChI=1S/C10H16N6O2/c11-2-4-13-9(17)10(18)15-8-1-3-14-16(8)7-5-12-6-7/h1,3,7,12H,2,4-6,11H2,(H,13,17)(H,15,18) |
| InChIKey | PVSPZTSPRSODQK-UHFFFAOYSA-N |
| XLogP | -1.96 |
| TPSA | 114.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.28 |
| LogP ≤ 5 | -1.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-(2-aminoethyl)-N'-[2-(azetidin-3-yl)pyrazol-3-yl]oxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-aminoethyl)-N'-[2-(azetidin-3-yl)pyrazol-3-yl]oxamide?
The IUPAC name of N-(2-aminoethyl)-N'-[2-(azetidin-3-yl)pyrazol-3-yl]oxamide (CID 165474686) is N-(2-aminoethyl)-N'-[2-(azetidin-3-yl)pyrazol-3-yl]oxamide.
What is the SMILES notation for N-(2-aminoethyl)-N'-[2-(azetidin-3-yl)pyrazol-3-yl]oxamide?
The canonical SMILES for N-(2-aminoethyl)-N'-[2-(azetidin-3-yl)pyrazol-3-yl]oxamide is NCCNC(=O)C(=O)Nc1ccnn1C1CNC1.
What is the InChIKey of N-(2-aminoethyl)-N'-[2-(azetidin-3-yl)pyrazol-3-yl]oxamide?
The InChIKey is PVSPZTSPRSODQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N6O2/c11-2-4-13-9(17)10(18)15-8-1-3-14-16(8)7-5-12-6-7/h1,3,7,12H,2,4-6,11H2,(H,13,17)(H,15,18).
What are the key properties of N-(2-aminoethyl)-N'-[2-(azetidin-3-yl)pyrazol-3-yl]oxamide?
N-(2-aminoethyl)-N'-[2-(azetidin-3-yl)pyrazol-3-yl]oxamide has a molecular weight of 252.28 g/mol, XLogP of -1.96, 4 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-aminoethyl)-N'-[2-(azetidin-3-yl)pyrazol-3-yl]oxamide is sourced from PubChem (CID 165474686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).