C17H28N4O4 — CID 165475381
tert-butyl 3-(5-amino-1-ethyl-3-methoxycarbonylpyrazol-4-yl)piperidine-1-carboxylate (PubChem CID 165475381) has the molecular formula C17H28N4O4 and a molecular weight of 352.44 g/mol. Its IUPAC name is tert-butyl 3-(5-amino-1-ethyl-3-methoxycarbonylpyrazol-4-yl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-(5-amino-1-ethyl-3-methoxycarbonylpyrazol-4-yl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 165475381 |
| Molecular Formula | C17H28N4O4 |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.21 |
| IUPAC Name | tert-butyl 3-(5-amino-1-ethyl-3-methoxycarbonylpyrazol-4-yl)piperidine-1-carboxylate |
| SMILES | CCn1nc(C(=O)OC)c(C2CCCN(C(=O)OC(C)(C)C)C2)c1N |
| InChI | InChI=1S/C17H28N4O4/c1-6-21-14(18)12(13(19-21)15(22)24-5)11-8-7-9-20(10-11)16(23)25-17(2,3)4/h11H,6-10,18H2,1-5H3 |
| InChIKey | VJYSOPWKMMHTGN-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 99.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |