About (3S,4R)-1-ethylpyrrolidine-3,4-diol;hydrochloride
(3S,4R)-1-ethylpyrrolidine-3,4-diol;hydrochloride (PubChem CID 165475445) has the molecular formula C6H14ClNO2
and a molecular weight of 167.64 g/mol. Its IUPAC name is (3S,4R)-1-ethylpyrrolidine-3,4-diol;hydrochloride.
Molecular Properties
| Compound Name | (3S,4R)-1-ethylpyrrolidine-3,4-diol;hydrochloride |
| PubChem CID | 165475445 |
| Molecular Formula | C6H14ClNO2 |
| Molecular Weight | 167.64 g/mol |
| Exact Mass | 167.07 |
| IUPAC Name | (3S,4R)-1-ethylpyrrolidine-3,4-diol;hydrochloride |
| SMILES | CCN1C[C@@H](O)[C@@H](O)C1.Cl |
| InChI | InChI=1S/C6H13NO2.ClH/c1-2-7-3-5(8)6(9)4-7;/h5-6,8-9H,2-4H2,1H3;1H/t5-,6+; |
| InChIKey | RVYYQDYXUZILTK-KNCHESJLSA-N |
| XLogP | -0.53 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.64 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3S,4R)-1-ethylpyrrolidine-3,4-diol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,4R)-1-ethylpyrrolidine-3,4-diol;hydrochloride?
The IUPAC name of (3S,4R)-1-ethylpyrrolidine-3,4-diol;hydrochloride (CID 165475445) is (3S,4R)-1-ethylpyrrolidine-3,4-diol;hydrochloride.
What is the SMILES notation for (3S,4R)-1-ethylpyrrolidine-3,4-diol;hydrochloride?
The canonical SMILES for (3S,4R)-1-ethylpyrrolidine-3,4-diol;hydrochloride is CCN1C[C@@H](O)[C@@H](O)C1.Cl.
What is the InChIKey of (3S,4R)-1-ethylpyrrolidine-3,4-diol;hydrochloride?
The InChIKey is RVYYQDYXUZILTK-KNCHESJLSA-N. The full InChI is InChI=1S/C6H13NO2.ClH/c1-2-7-3-5(8)6(9)4-7;/h5-6,8-9H,2-4H2,1H3;1H/t5-,6+;.
What are the key properties of (3S,4R)-1-ethylpyrrolidine-3,4-diol;hydrochloride?
(3S,4R)-1-ethylpyrrolidine-3,4-diol;hydrochloride has a molecular weight of 167.64 g/mol, XLogP of -0.53, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,4R)-1-ethylpyrrolidine-3,4-diol;hydrochloride is sourced from PubChem (CID 165475445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).