About 1-(4-amino-2,3-dihydro-1H-inden-1-yl)-3-propan-2-ylurea
1-(4-amino-2,3-dihydro-1H-inden-1-yl)-3-propan-2-ylurea (PubChem CID 165476164) has the molecular formula C13H19N3O
and a molecular weight of 233.31 g/mol. Its IUPAC name is 1-(4-amino-2,3-dihydro-1H-inden-1-yl)-3-propan-2-ylurea.
Molecular Properties
| Compound Name | 1-(4-amino-2,3-dihydro-1H-inden-1-yl)-3-propan-2-ylurea |
| PubChem CID | 165476164 |
| Molecular Formula | C13H19N3O |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.15 |
| IUPAC Name | 1-(4-amino-2,3-dihydro-1H-inden-1-yl)-3-propan-2-ylurea |
| SMILES | CC(C)NC(=O)NC1CCc2c(N)cccc21 |
| InChI | InChI=1S/C13H19N3O/c1-8(2)15-13(17)16-12-7-6-9-10(12)4-3-5-11(9)14/h3-5,8,12H,6-7,14H2,1-2H3,(H2,15,16,17) |
| InChIKey | INCWUKMYGVSSOA-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-amino-2,3-dihydro-1H-inden-1-yl)-3-propan-2-ylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-amino-2,3-dihydro-1H-inden-1-yl)-3-propan-2-ylurea?
The IUPAC name of 1-(4-amino-2,3-dihydro-1H-inden-1-yl)-3-propan-2-ylurea (CID 165476164) is 1-(4-amino-2,3-dihydro-1H-inden-1-yl)-3-propan-2-ylurea.
What is the SMILES notation for 1-(4-amino-2,3-dihydro-1H-inden-1-yl)-3-propan-2-ylurea?
The canonical SMILES for 1-(4-amino-2,3-dihydro-1H-inden-1-yl)-3-propan-2-ylurea is CC(C)NC(=O)NC1CCc2c(N)cccc21.
What is the InChIKey of 1-(4-amino-2,3-dihydro-1H-inden-1-yl)-3-propan-2-ylurea?
The InChIKey is INCWUKMYGVSSOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N3O/c1-8(2)15-13(17)16-12-7-6-9-10(12)4-3-5-11(9)14/h3-5,8,12H,6-7,14H2,1-2H3,(H2,15,16,17).
What are the key properties of 1-(4-amino-2,3-dihydro-1H-inden-1-yl)-3-propan-2-ylurea?
1-(4-amino-2,3-dihydro-1H-inden-1-yl)-3-propan-2-ylurea has a molecular weight of 233.31 g/mol, XLogP of 1.96, 2 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-amino-2,3-dihydro-1H-inden-1-yl)-3-propan-2-ylurea is sourced from PubChem (CID 165476164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).