C9H7ClF3N3O — CID 165476214
5-chloro-2-(methoxymethyl)-7-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyridine (PubChem CID 165476214) has the molecular formula C9H7ClF3N3O and a molecular weight of 265.62 g/mol. Its IUPAC name is 5-chloro-2-(methoxymethyl)-7-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyridine.
| Compound Name | 5-chloro-2-(methoxymethyl)-7-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 165476214 |
| Molecular Formula | C9H7ClF3N3O |
| Molecular Weight | 265.62 g/mol |
| Exact Mass | 265.02 |
| IUPAC Name | 5-chloro-2-(methoxymethyl)-7-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyridine |
| SMILES | COCc1nc2cc(C(F)(F)F)cc(Cl)n2n1 |
| InChI | InChI=1S/C9H7ClF3N3O/c1-17-4-7-14-8-3-5(9(11,12)13)2-6(10)16(8)15-7/h2-3H,4H2,1H3 |
| InChIKey | NUJSJEJNVOMJDS-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 39.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.62 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|